About 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid
4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid (PubChem CID 67349260) has the molecular formula C22H20FN3O4
and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid.
Molecular Properties
| Compound Name | 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
| PubChem CID | 67349260 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid |
| SMILES | COc1ccc(C2(c3cccc(-c4cccnc4)c3)COC(N)=N2)cc1F.O=CO |
| InChI | InChI=1S/C21H18FN3O2.CH2O2/c1-26-19-8-7-17(11-18(19)22)21(13-27-20(23)25-21)16-6-2-4-14(10-16)15-5-3-9-24-12-15;2-1-3/h2-12H,13H2,1H3,(H2,23,25);1H,(H,2,3) |
| InChIKey | JOJIQIWUOSYLCJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid?
The IUPAC name of 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid (CID 67349260) is 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid.
What is the SMILES notation for 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid?
The canonical SMILES for 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid is COc1ccc(C2(c3cccc(-c4cccnc4)c3)COC(N)=N2)cc1F.O=CO.
What is the InChIKey of 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid?
The InChIKey is JOJIQIWUOSYLCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18FN3O2.CH2O2/c1-26-19-8-7-17(11-18(19)22)21(13-27-20(23)25-21)16-6-2-4-14(10-16)15-5-3-9-24-12-15;2-1-3/h2-12H,13H2,1H3,(H2,23,25);1H,(H,2,3).
What are the key properties of 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid?
4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid has a molecular weight of 409.42 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoro-4-methoxyphenyl)-4-(3-pyridin-3-ylphenyl)-5H-1,3-oxazol-2-amine;formic acid is sourced from PubChem (CID 67349260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).