About (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine
(4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine (PubChem CID 67349588) has the molecular formula C23H22FN3O2
and a molecular weight of 391.45 g/mol. Its IUPAC name is (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine |
| PubChem CID | 67349588 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine |
| SMILES | CC(C)Oc1ccc([C@]2(c3cccc(-c4cccnc4F)c3)COC(N)=N2)cc1 |
| InChI | InChI=1S/C23H22FN3O2/c1-15(2)29-19-10-8-17(9-11-19)23(14-28-22(25)27-23)18-6-3-5-16(13-18)20-7-4-12-26-21(20)24/h3-13,15H,14H2,1-2H3,(H2,25,27)/t23-/m0/s1 |
| InChIKey | MZVHAUXOAGMXGW-QHCPKHFHSA-N |
| XLogP | 4.26 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine?
The IUPAC name of (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine (CID 67349588) is (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine.
What is the SMILES notation for (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine?
The canonical SMILES for (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine is CC(C)Oc1ccc([C@]2(c3cccc(-c4cccnc4F)c3)COC(N)=N2)cc1.
What is the InChIKey of (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine?
The InChIKey is MZVHAUXOAGMXGW-QHCPKHFHSA-N. The full InChI is InChI=1S/C23H22FN3O2/c1-15(2)29-19-10-8-17(9-11-19)23(14-28-22(25)27-23)18-6-3-5-16(13-18)20-7-4-12-26-21(20)24/h3-13,15H,14H2,1-2H3,(H2,25,27)/t23-/m0/s1.
What are the key properties of (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine?
(4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine has a molecular weight of 391.45 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[3-(2-fluoro-3-pyridinyl)phenyl]-4-(4-propan-2-yloxyphenyl)-5H-1,3-oxazol-2-amine is sourced from PubChem (CID 67349588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).