About (4-chloro-2-ethylphenyl) hydrogen carbonate
(4-chloro-2-ethylphenyl) hydrogen carbonate (PubChem CID 67350098) has the molecular formula C9H9ClO3
and a molecular weight of 200.62 g/mol. Its IUPAC name is (4-chloro-2-ethylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (4-chloro-2-ethylphenyl) hydrogen carbonate |
| PubChem CID | 67350098 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (4-chloro-2-ethylphenyl) hydrogen carbonate |
| SMILES | CCc1cc(Cl)ccc1OC(=O)O |
| InChI | InChI=1S/C9H9ClO3/c1-2-6-5-7(10)3-4-8(6)13-9(11)12/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | XLNPWLGQQJAVHA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2-ethylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-ethylphenyl) hydrogen carbonate?
The IUPAC name of (4-chloro-2-ethylphenyl) hydrogen carbonate (CID 67350098) is (4-chloro-2-ethylphenyl) hydrogen carbonate.
What is the SMILES notation for (4-chloro-2-ethylphenyl) hydrogen carbonate?
The canonical SMILES for (4-chloro-2-ethylphenyl) hydrogen carbonate is CCc1cc(Cl)ccc1OC(=O)O.
What is the InChIKey of (4-chloro-2-ethylphenyl) hydrogen carbonate?
The InChIKey is XLNPWLGQQJAVHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO3/c1-2-6-5-7(10)3-4-8(6)13-9(11)12/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of (4-chloro-2-ethylphenyl) hydrogen carbonate?
(4-chloro-2-ethylphenyl) hydrogen carbonate has a molecular weight of 200.62 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-ethylphenyl) hydrogen carbonate is sourced from PubChem (CID 67350098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).