C21H32N2O4SSi — CID 67350336
5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one (PubChem CID 67350336) has the molecular formula C21H32N2O4SSi and a molecular weight of 436.65 g/mol. Its IUPAC name is 5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one.
| Compound Name | 5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67350336 |
| Molecular Formula | C21H32N2O4SSi |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3-(3-oxo-4H-1,4-benzothiazin-6-yl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC1CN(c2ccc3c(c2)NC(=O)CS3)C(=O)O1 |
| InChI | InChI=1S/C21H32N2O4SSi/c1-21(2,3)29(4,5)26-11-7-6-8-16-13-23(20(25)27-16)15-9-10-18-17(12-15)22-19(24)14-28-18/h9-10,12,16H,6-8,11,13-14H2,1-5H3,(H,22,24) |
| InChIKey | FOURYRKCIOKIPC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|