About oxadiazolo[5,4-b]pyridine-5-carboxylic acid
oxadiazolo[5,4-b]pyridine-5-carboxylic acid (PubChem CID 67350430) has the molecular formula C6H3N3O3
and a molecular weight of 165.11 g/mol. Its IUPAC name is oxadiazolo[5,4-b]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | oxadiazolo[5,4-b]pyridine-5-carboxylic acid |
| PubChem CID | 67350430 |
| Molecular Formula | C6H3N3O3 |
| Molecular Weight | 165.11 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | oxadiazolo[5,4-b]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nnoc2n1 |
| InChI | InChI=1S/C6H3N3O3/c10-6(11)4-2-1-3-5(7-4)12-9-8-3/h1-2H,(H,10,11) |
| InChIKey | GMHRDDPYXMUBRG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.11 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxadiazolo[5,4-b]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazolo[5,4-b]pyridine-5-carboxylic acid?
The IUPAC name of oxadiazolo[5,4-b]pyridine-5-carboxylic acid (CID 67350430) is oxadiazolo[5,4-b]pyridine-5-carboxylic acid.
What is the SMILES notation for oxadiazolo[5,4-b]pyridine-5-carboxylic acid?
The canonical SMILES for oxadiazolo[5,4-b]pyridine-5-carboxylic acid is O=C(O)c1ccc2nnoc2n1.
What is the InChIKey of oxadiazolo[5,4-b]pyridine-5-carboxylic acid?
The InChIKey is GMHRDDPYXMUBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O3/c10-6(11)4-2-1-3-5(7-4)12-9-8-3/h1-2H,(H,10,11).
What are the key properties of oxadiazolo[5,4-b]pyridine-5-carboxylic acid?
oxadiazolo[5,4-b]pyridine-5-carboxylic acid has a molecular weight of 165.11 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazolo[5,4-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 67350430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).