About 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate
2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate (PubChem CID 6735134) has the molecular formula C18H17BrN4O3S2
and a molecular weight of 481.40 g/mol. Its IUPAC name is 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate |
| PubChem CID | 6735134 |
| Molecular Formula | C18H17BrN4O3S2 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 479.99 |
| IUPAC Name | 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate |
| SMILES | Cc1csc2c(SCC(=O)NNC(=O)OCCc3ccccc3Br)ncnc12 |
| InChI | InChI=1S/C18H17BrN4O3S2/c1-11-8-27-16-15(11)20-10-21-17(16)28-9-14(24)22-23-18(25)26-7-6-12-4-2-3-5-13(12)19/h2-5,8,10H,6-7,9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | PYNSDMNQLHWCBM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate?
The IUPAC name of 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate (CID 6735134) is 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate.
What is the SMILES notation for 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate?
The canonical SMILES for 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate is Cc1csc2c(SCC(=O)NNC(=O)OCCc3ccccc3Br)ncnc12.
What is the InChIKey of 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate?
The InChIKey is PYNSDMNQLHWCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN4O3S2/c1-11-8-27-16-15(11)20-10-21-17(16)28-9-14(24)22-23-18(25)26-7-6-12-4-2-3-5-13(12)19/h2-5,8,10H,6-7,9H2,1H3,(H,22,24)(H,23,25).
What are the key properties of 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate?
2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate has a molecular weight of 481.40 g/mol, XLogP of 3.85, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)ethyl N-[[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylacetyl]amino]carbamate is sourced from PubChem (CID 6735134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).