C30H33F3O8S — CID 67351612
(2S,3R,4S,5R,6R)-2,3-dimethoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(trifluoromethylsulfonyl)oxane (PubChem CID 67351612) has the molecular formula C30H33F3O8S and a molecular weight of 610.65 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2,3-dimethoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(trifluoromethylsulfonyl)oxane.
| Compound Name | (2S,3R,4S,5R,6R)-2,3-dimethoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(trifluoromethylsulfonyl)oxane |
|---|---|
| PubChem CID | 67351612 |
| Molecular Formula | C30H33F3O8S |
| Molecular Weight | 610.65 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2,3-dimethoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-3-(trifluoromethylsulfonyl)oxane |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@]1(OC)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C30H33F3O8S/c1-36-28-29(37-2,42(34,35)30(31,32)33)27(40-20-24-16-10-5-11-17-24)26(39-19-23-14-8-4-9-15-23)25(41-28)21-38-18-22-12-6-3-7-13-22/h3-17,25-28H,18-21H2,1-2H3/t25-,26-,27+,28+,29-/m1/s1 |
| InChIKey | FNUUBZIAWPDKLF-MJXUZWQSSA-N |
| XLogP | 5.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |