C11H20F2N2O2 — CID 67351759
[(1R,2S)-2-amino-3,3-difluorocyclohexyl]-tert-butylcarbamic acid (PubChem CID 67351759) has the molecular formula C11H20F2N2O2 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(1R,2S)-2-amino-3,3-difluorocyclohexyl]-tert-butylcarbamic acid.
| Compound Name | [(1R,2S)-2-amino-3,3-difluorocyclohexyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67351759 |
| Molecular Formula | C11H20F2N2O2 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [(1R,2S)-2-amino-3,3-difluorocyclohexyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@H]1CCCC(F)(F)[C@H]1N |
| InChI | InChI=1S/C11H20F2N2O2/c1-10(2,3)15(9(16)17)7-5-4-6-11(12,13)8(7)14/h7-8H,4-6,14H2,1-3H3,(H,16,17)/t7-,8+/m1/s1 |
| InChIKey | FOWSKENLHFKAKP-SFYZADRCSA-N |
| XLogP | 2.28 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |