C37H48O5 — CID 67351778
[(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 67351778) has the molecular formula C37H48O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is [(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 67351778 |
| Molecular Formula | C37H48O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | [(2R)-2,7,8-trimethyl-2-(4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dihydrochromen-6-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC[C@]1(C)CCc2cc(OC(=O)C=Cc3ccc(O)c(O)c3)c(C)c(C)c2O1 |
| InChI | InChI=1S/C37H48O5/c1-25(2)11-8-12-26(3)13-9-14-27(4)15-10-21-37(7)22-20-31-24-34(28(5)29(6)36(31)42-37)41-35(40)19-17-30-16-18-32(38)33(39)23-30/h11,13,15-19,23-24,38-39H,8-10,12,14,20-22H2,1-7H3/t37-/m1/s1 |
| InChIKey | ZPBJHWPADLSVOX-DIPNUNPCSA-N |
| XLogP | 9.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|