C19H23N7O — CID 67352101
N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide (PubChem CID 67352101) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide.
| Compound Name | N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 67352101 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C19H23N7O/c1-13(27)22-12-17-24-16-11-23-19-15(3-7-21-19)18(16)26(17)14-4-9-25(10-5-14)8-2-6-20/h3,7,11,14H,2,4-5,8-10,12H2,1H3,(H,21,23)(H,22,27) |
| InChIKey | UTZZUPODPHWAMC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |