About 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid
3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid (PubChem CID 67352102) has the molecular formula C20H16N4O4
and a molecular weight of 376.37 g/mol. Its IUPAC name is 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid |
| PubChem CID | 67352102 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)n1cnc2ccc(NC(=O)c3ccno3)cc21 |
| InChI | InChI=1S/C20H16N4O4/c25-19(26)11-16(13-4-2-1-3-5-13)24-12-21-15-7-6-14(10-17(15)24)23-20(27)18-8-9-22-28-18/h1-10,12,16H,11H2,(H,23,27)(H,25,26) |
| InChIKey | SHWGPSVRWYZLPS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid?
The IUPAC name of 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid (CID 67352102) is 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid.
What is the SMILES notation for 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid?
The canonical SMILES for 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid is O=C(O)CC(c1ccccc1)n1cnc2ccc(NC(=O)c3ccno3)cc21.
What is the InChIKey of 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid?
The InChIKey is SHWGPSVRWYZLPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O4/c25-19(26)11-16(13-4-2-1-3-5-13)24-12-21-15-7-6-14(10-17(15)24)23-20(27)18-8-9-22-28-18/h1-10,12,16H,11H2,(H,23,27)(H,25,26).
What are the key properties of 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid?
3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid has a molecular weight of 376.37 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(1,2-oxazole-5-carbonylamino)benzimidazol-1-yl]-3-phenylpropanoic acid is sourced from PubChem (CID 67352102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).