C22H25N7O2 — CID 67352159
(3S)-3-amino-13-ethyl-8-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 67352159) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is (3S)-3-amino-13-ethyl-8-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (3S)-3-amino-13-ethyl-8-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 67352159 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (3S)-3-amino-13-ethyl-8-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCc1ncc2c(n1)N1C(CC[C@H]1N)CN(c1cccc(-c3nnc(CC)o3)c1)C2=O |
| InChI | InChI=1S/C22H25N7O2/c1-3-18-24-11-16-20(25-18)29-15(8-9-17(29)23)12-28(22(16)30)14-7-5-6-13(10-14)21-27-26-19(4-2)31-21/h5-7,10-11,15,17H,3-4,8-9,12,23H2,1-2H3/t15?,17-/m0/s1 |
| InChIKey | SYNWSGQSGGPDBJ-LWKPJOBUSA-N |
| XLogP | 2.57 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |