C20H25N7O2 — CID 67352386
ethyl N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate (PubChem CID 67352386) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is ethyl N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate.
| Compound Name | ethyl N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 67352386 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | ethyl N-[[3-[1-(2-cyanoethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C20H25N7O2/c1-2-29-20(28)24-13-17-25-16-12-23-19-15(4-8-22-19)18(16)27(17)14-5-10-26(11-6-14)9-3-7-21/h4,8,12,14H,2-3,5-6,9-11,13H2,1H3,(H,22,23)(H,24,28) |
| InChIKey | KBCYHNNFEYIPGS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |