C24H31N5O5S2 — CID 67352656
N-[[10-(benzenesulfonyl)-4,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]-[4-(methoxymethyl)cyclohexyl]methyl]methanesulfonamide (PubChem CID 67352656) has the molecular formula C24H31N5O5S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is N-[[10-(benzenesulfonyl)-4,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]-[4-(methoxymethyl)cyclohexyl]methyl]methanesulfonamide.
| Compound Name | N-[[10-(benzenesulfonyl)-4,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]-[4-(methoxymethyl)cyclohexyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 67352656 |
| Molecular Formula | C24H31N5O5S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | N-[[10-(benzenesulfonyl)-4,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-yl]-[4-(methoxymethyl)cyclohexyl]methyl]methanesulfonamide |
| SMILES | COCC1CCC(C(NS(C)(=O)=O)N2Cc3c(cnc4c3ccn4S(=O)(=O)c3ccccc3)N2)CC1 |
| InChI | InChI=1S/C24H31N5O5S2/c1-34-16-17-8-10-18(11-9-17)23(27-35(2,30)31)28-15-21-20-12-13-29(24(20)25-14-22(21)26-28)36(32,33)19-6-4-3-5-7-19/h3-7,12-14,17-18,23,26-27H,8-11,15-16H2,1-2H3 |
| InChIKey | UTQCPMDIZHARNZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |