C32H37F2NO6 — CID 67352786
[2-[(1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-6-(4-methoxyphenyl)-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethyl] acetate (PubChem CID 67352786) has the molecular formula C32H37F2NO6 and a molecular weight of 569.65 g/mol. Its IUPAC name is [2-[(1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-6-(4-methoxyphenyl)-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-6-(4-methoxyphenyl)-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 67352786 |
| Molecular Formula | C32H37F2NO6 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | [2-[(1S,2S,4R,8S,9S,11S,12R,13S,19S)-12,19-difluoro-11-hydroxy-6-(4-methoxyphenyl)-9,13-dimethyl-16-oxo-6-azapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-8-yl]-2-oxoethyl] acetate |
| SMILES | COc1ccc(N2C[C@@H]3C[C@H]4[C@@H]5C[C@H](F)C6=CC(=O)C=C[C@]6(C)[C@@]5(F)[C@@H](O)C[C@]4(C)[C@]3(C(=O)COC(C)=O)C2)cc1 |
| InChI | InChI=1S/C32H37F2NO6/c1-18(36)41-16-28(39)31-17-35(20-5-7-22(40-4)8-6-20)15-19(31)11-23-24-13-26(33)25-12-21(37)9-10-29(25,2)32(24,34)27(38)14-30(23,31)3/h5-10,12,19,23-24,26-27,38H,11,13-17H2,1-4H3/t19-,23-,24-,26-,27-,29-,30-,31+,32-/m0/s1 |
| InChIKey | PUEZLRMHQKLVMR-PAKUBRQUSA-N |
| XLogP | 4.18 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|