C21H23N7O3 — CID 67352864
5-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-3-methyl-1,3,4-oxadiazol-2-one (PubChem CID 67352864) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 5-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-3-methyl-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-3-methyl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 67352864 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 5-[3-[13-(ethylamino)-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl]phenyl]-3-methyl-1,3,4-oxadiazol-2-one |
| SMILES | CCNc1ncc2c(n1)N1CCCC1CN(c1cccc(-c3nn(C)c(=O)o3)c1)C2=O |
| InChI | InChI=1S/C21H23N7O3/c1-3-22-20-23-11-16-17(24-20)27-9-5-8-15(27)12-28(19(16)29)14-7-4-6-13(10-14)18-25-26(2)21(30)31-18/h4,6-7,10-11,15H,3,5,8-9,12H2,1-2H3,(H,22,23,24) |
| InChIKey | WYQHNTZFXGIJPL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |