C23H27N5O6S — CID 67353734
tert-butyl N-[(1R,3R)-3-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]carbamate (PubChem CID 67353734) has the molecular formula C23H27N5O6S and a molecular weight of 501.57 g/mol. Its IUPAC name is tert-butyl N-[(1R,3R)-3-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3R)-3-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 67353734 |
| Molecular Formula | C23H27N5O6S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | tert-butyl N-[(1R,3R)-3-[[1-(benzenesulfonyl)-5-nitropyrrolo[2,3-b]pyridin-4-yl]amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](Nc2c([N+](=O)[O-])cnc3c2ccn3S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C23H27N5O6S/c1-23(2,3)34-22(29)26-16-10-9-15(13-16)25-20-18-11-12-27(21(18)24-14-19(20)28(30)31)35(32,33)17-7-5-4-6-8-17/h4-8,11-12,14-16H,9-10,13H2,1-3H3,(H,24,25)(H,26,29)/t15-,16-/m1/s1 |
| InChIKey | UZWZHGJBKOAAOK-HZPDHXFCSA-N |
| XLogP | 4.04 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|