About 1,3-diphenylisoindole-2,5,6-triamine
1,3-diphenylisoindole-2,5,6-triamine (PubChem CID 67353834) has the molecular formula C20H18N4
and a molecular weight of 314.39 g/mol. Its IUPAC name is 1,3-diphenylisoindole-2,5,6-triamine.
Molecular Properties
| Compound Name | 1,3-diphenylisoindole-2,5,6-triamine |
| PubChem CID | 67353834 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1,3-diphenylisoindole-2,5,6-triamine |
| SMILES | Nc1cc2c(-c3ccccc3)n(N)c(-c3ccccc3)c2cc1N |
| InChI | InChI=1S/C20H18N4/c21-17-11-15-16(12-18(17)22)20(14-9-5-2-6-10-14)24(23)19(15)13-7-3-1-4-8-13/h1-12H,21-23H2 |
| InChIKey | VAHCDSFPLFCFGS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diphenylisoindole-2,5,6-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenylisoindole-2,5,6-triamine?
The IUPAC name of 1,3-diphenylisoindole-2,5,6-triamine (CID 67353834) is 1,3-diphenylisoindole-2,5,6-triamine.
What is the SMILES notation for 1,3-diphenylisoindole-2,5,6-triamine?
The canonical SMILES for 1,3-diphenylisoindole-2,5,6-triamine is Nc1cc2c(-c3ccccc3)n(N)c(-c3ccccc3)c2cc1N.
What is the InChIKey of 1,3-diphenylisoindole-2,5,6-triamine?
The InChIKey is VAHCDSFPLFCFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4/c21-17-11-15-16(12-18(17)22)20(14-9-5-2-6-10-14)24(23)19(15)13-7-3-1-4-8-13/h1-12H,21-23H2.
What are the key properties of 1,3-diphenylisoindole-2,5,6-triamine?
1,3-diphenylisoindole-2,5,6-triamine has a molecular weight of 314.39 g/mol, XLogP of 3.85, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenylisoindole-2,5,6-triamine is sourced from PubChem (CID 67353834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).