C27H34N8O2 — CID 67355554
7-cyclohexyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 67355554) has the molecular formula C27H34N8O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 7-cyclohexyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclohexyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 67355554 |
| Molecular Formula | C27H34N8O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 7-cyclohexyl-N,N-dimethyl-2-[[5-(1-oxo-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCN5CCCC5C4=O)cn3)nc2n1C1CCCCC1 |
| InChI | InChI=1S/C27H34N8O2/c1-32(2)25(36)22-15-18-16-29-27(31-24(18)35(22)19-7-4-3-5-8-19)30-23-11-10-20(17-28-23)34-14-13-33-12-6-9-21(33)26(34)37/h10-11,15-17,19,21H,3-9,12-14H2,1-2H3,(H,28,29,30,31) |
| InChIKey | BXXWHFGJPHSCSJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |