C12H14N4O — CID 67355578
2-(6-amino-3-pyridinyl)-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 67355578) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-(6-amino-3-pyridinyl)-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 2-(6-amino-3-pyridinyl)-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 67355578 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2-(6-amino-3-pyridinyl)-3,4,6,7-tetrahydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | Nc1ccc(N2CCN3CCC=C3C2=O)cn1 |
| InChI | InChI=1S/C12H14N4O/c13-11-4-3-9(8-14-11)16-7-6-15-5-1-2-10(15)12(16)17/h2-4,8H,1,5-7H2,(H2,13,14) |
| InChIKey | PYTLQLDSVPSSHU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|