About (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid
(2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid (PubChem CID 67355937) has the molecular formula C8H13N5O2
and a molecular weight of 211.22 g/mol. Its IUPAC name is (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid |
| PubChem CID | 67355937 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid |
| SMILES | N[C@@H](CCCNc1nccnn1)C(=O)O |
| InChI | InChI=1S/C8H13N5O2/c9-6(7(14)15)2-1-3-10-8-11-4-5-12-13-8/h4-6H,1-3,9H2,(H,14,15)(H,10,11,13)/t6-/m0/s1 |
| InChIKey | TVNBKQZISQTICU-LURJTMIESA-N |
| XLogP | -0.52 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid?
The IUPAC name of (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid (CID 67355937) is (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid.
What is the SMILES notation for (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid?
The canonical SMILES for (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid is N[C@@H](CCCNc1nccnn1)C(=O)O.
What is the InChIKey of (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid?
The InChIKey is TVNBKQZISQTICU-LURJTMIESA-N. The full InChI is InChI=1S/C8H13N5O2/c9-6(7(14)15)2-1-3-10-8-11-4-5-12-13-8/h4-6H,1-3,9H2,(H,14,15)(H,10,11,13)/t6-/m0/s1.
What are the key properties of (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid?
(2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid has a molecular weight of 211.22 g/mol, XLogP of -0.52, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-5-(1,2,4-triazin-3-ylamino)pentanoic acid is sourced from PubChem (CID 67355937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).