2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid

C9H15N5O2 — CID 67355938

IUPAC2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid
SMILESNC(CCCCNc1nccnn1)C(=O)O
InChIInChI=1S/C9H15N5O2/c10-7(8(15)16)3-1-2-4-11-9-12-5-6-13-14-9/h5-7H,1-4,10H2,(H,15,16)(H,11,12,14)
InChIKeyQWNYHNVXVBTAAQ-UHFFFAOYSA-N
MW225.25 g/mol
LogP-0.13
Rot. Bonds7

About 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid

2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid (PubChem CID 67355938) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid.

Molecular Properties

Compound Name2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid
PubChem CID67355938
Molecular FormulaC9H15N5O2
Molecular Weight225.25 g/mol
Exact Mass225.12
IUPAC Name2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid
SMILESNC(CCCCNc1nccnn1)C(=O)O
InChIInChI=1S/C9H15N5O2/c10-7(8(15)16)3-1-2-4-11-9-12-5-6-13-14-9/h5-7H,1-4,10H2,(H,15,16)(H,11,12,14)
InChIKeyQWNYHNVXVBTAAQ-UHFFFAOYSA-N
XLogP-0.13
TPSA114.02 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.25
LogP ≤ 5-0.13
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid?
The IUPAC name of 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid (CID 67355938) is 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid.
What is the SMILES notation for 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid?
The canonical SMILES for 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid is NC(CCCCNc1nccnn1)C(=O)O.
What is the InChIKey of 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid?
The InChIKey is QWNYHNVXVBTAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O2/c10-7(8(15)16)3-1-2-4-11-9-12-5-6-13-14-9/h5-7H,1-4,10H2,(H,15,16)(H,11,12,14).
What are the key properties of 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid?
2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid has a molecular weight of 225.25 g/mol, XLogP of -0.13, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(1,2,4-triazin-3-ylamino)hexanoic acid is sourced from PubChem (CID 67355938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).