C10H19F3OSi — CID 67357109
2,6-dimethyl-2-(3,4,4-trifluorobutyl)oxasilinane (PubChem CID 67357109) has the molecular formula C10H19F3OSi and a molecular weight of 240.34 g/mol. Its IUPAC name is 2,6-dimethyl-2-(3,4,4-trifluorobutyl)oxasilinane.
| Compound Name | 2,6-dimethyl-2-(3,4,4-trifluorobutyl)oxasilinane |
|---|---|
| PubChem CID | 67357109 |
| Molecular Formula | C10H19F3OSi |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,6-dimethyl-2-(3,4,4-trifluorobutyl)oxasilinane |
| SMILES | CC1CCC[Si](C)(CCC(F)C(F)F)O1 |
| InChI | InChI=1S/C10H19F3OSi/c1-8-4-3-6-15(2,14-8)7-5-9(11)10(12)13/h8-10H,3-7H2,1-2H3 |
| InChIKey | OVYRCJNGQNSRSD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|