C16H21FN3O5PS — CID 67357301
[4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]methylphosphonic acid (PubChem CID 67357301) has the molecular formula C16H21FN3O5PS and a molecular weight of 417.40 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]methylphosphonic acid.
| Compound Name | [4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 67357301 |
| Molecular Formula | C16H21FN3O5PS |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [4-(4-fluorophenyl)-2-[methyl(methylsulfonyl)amino]-6-propan-2-ylpyrimidin-5-yl]methylphosphonic acid |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1CP(=O)(O)O |
| InChI | InChI=1S/C16H21FN3O5PS/c1-10(2)14-13(9-26(21,22)23)15(11-5-7-12(17)8-6-11)19-16(18-14)20(3)27(4,24)25/h5-8,10H,9H2,1-4H3,(H2,21,22,23) |
| InChIKey | MJCMBTPUDFHXFJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|