About (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid
(2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid (PubChem CID 67357667) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid |
| PubChem CID | 67357667 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid |
| SMILES | N[C@@H](CCNc1nccnn1)C(=O)O |
| InChI | InChI=1S/C7H11N5O2/c8-5(6(13)14)1-2-9-7-10-3-4-11-12-7/h3-5H,1-2,8H2,(H,13,14)(H,9,10,12)/t5-/m0/s1 |
| InChIKey | QGIDZWGYHTZKST-YFKPBYRVSA-N |
| XLogP | -0.91 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid?
The IUPAC name of (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid (CID 67357667) is (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid.
What is the SMILES notation for (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid?
The canonical SMILES for (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid is N[C@@H](CCNc1nccnn1)C(=O)O.
What is the InChIKey of (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid?
The InChIKey is QGIDZWGYHTZKST-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11N5O2/c8-5(6(13)14)1-2-9-7-10-3-4-11-12-7/h3-5H,1-2,8H2,(H,13,14)(H,9,10,12)/t5-/m0/s1.
What are the key properties of (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid?
(2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid has a molecular weight of 197.20 g/mol, XLogP of -0.91, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-4-(1,2,4-triazin-3-ylamino)butanoic acid is sourced from PubChem (CID 67357667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).