C19H24N2O2S — CID 67357840
tert-butyl 2-(4-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxylate (PubChem CID 67357840) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is tert-butyl 2-(4-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67357840 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl 2-(4-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H24N2O2S/c1-19(2,3)23-18(22)21-12-8-7-11-16(21)17-20-15(13-24-17)14-9-5-4-6-10-14/h4-6,9-10,13,16H,7-8,11-12H2,1-3H3 |
| InChIKey | HFHMZATXPZTGCB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |