C32H39ClN6OS — CID 67358048
7-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butyl]-2-propan-2-yl-5,6,8,9-tetrahydro-1H-pyrrolo[3,4-h][3]benzazepin-3-one;hydrochloride (PubChem CID 67358048) has the molecular formula C32H39ClN6OS and a molecular weight of 591.23 g/mol. Its IUPAC name is 7-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butyl]-2-propan-2-yl-5,6,8,9-tetrahydro-1H-pyrrolo[3,4-h][3]benzazepin-3-one;hydrochloride.
| Compound Name | 7-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butyl]-2-propan-2-yl-5,6,8,9-tetrahydro-1H-pyrrolo[3,4-h][3]benzazepin-3-one;hydrochloride |
|---|---|
| PubChem CID | 67358048 |
| Molecular Formula | C32H39ClN6OS |
| Molecular Weight | 591.23 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 7-[4-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]butyl]-2-propan-2-yl-5,6,8,9-tetrahydro-1H-pyrrolo[3,4-h][3]benzazepin-3-one;hydrochloride |
| SMILES | Cc1ccc2c(-c3nnc(SCCCCN4CCc5cc6c(cc5CC4)C(=O)N(C(C)C)C6)n3C)cccc2n1.Cl |
| InChI | InChI=1S/C32H38N6OS.ClH/c1-21(2)38-20-25-18-23-12-15-37(16-13-24(23)19-28(25)31(38)39)14-5-6-17-40-32-35-34-30(36(32)4)27-8-7-9-29-26(27)11-10-22(3)33-29;/h7-11,18-19,21H,5-6,12-17,20H2,1-4H3;1H |
| InChIKey | OABFYJGTBMSGQK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.23 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|