C30H33ClN6OS — CID 67358553
2-cyclopropyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine;hydrochloride (PubChem CID 67358553) has the molecular formula C30H33ClN6OS and a molecular weight of 561.16 g/mol. Its IUPAC name is 2-cyclopropyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine;hydrochloride.
| Compound Name | 2-cyclopropyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine;hydrochloride |
|---|---|
| PubChem CID | 67358553 |
| Molecular Formula | C30H33ClN6OS |
| Molecular Weight | 561.16 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-cyclopropyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine;hydrochloride |
| SMILES | Cc1ccc2c(-c3nnc(SCCCN4CCc5cc6nc(C7CC7)oc6cc5CC4)n3C)cccc2n1.Cl |
| InChI | InChI=1S/C30H32N6OS.ClH/c1-19-7-10-23-24(5-3-6-25(23)31-19)28-33-34-30(35(28)2)38-16-4-13-36-14-11-21-17-26-27(18-22(21)12-15-36)37-29(32-26)20-8-9-20;/h3,5-7,10,17-18,20H,4,8-9,11-16H2,1-2H3;1H |
| InChIKey | ITMBHAHQHLUVPG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.16 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|