C30H29FN2O3 — CID 67358648
2-[3-[benzyl(2-phenylethyl)carbamoyl]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid (PubChem CID 67358648) has the molecular formula C30H29FN2O3 and a molecular weight of 484.57 g/mol. Its IUPAC name is 2-[3-[benzyl(2-phenylethyl)carbamoyl]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid.
| Compound Name | 2-[3-[benzyl(2-phenylethyl)carbamoyl]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
|---|---|
| PubChem CID | 67358648 |
| Molecular Formula | C30H29FN2O3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 2-[3-[benzyl(2-phenylethyl)carbamoyl]-6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3cc(F)ccc31)CC(C(=O)N(CCc1ccccc1)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C30H29FN2O3/c31-24-12-14-28-26(18-24)25-17-23(11-13-27(25)33(28)20-29(34)35)30(36)32(19-22-9-5-2-6-10-22)16-15-21-7-3-1-4-8-21/h1-10,12,14,18,23H,11,13,15-17,19-20H2,(H,34,35) |
| InChIKey | FHHSYNMECGZZSU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|