About azane;4-cyclohexyloxan-3-amine;hydrochloride
azane;4-cyclohexyloxan-3-amine;hydrochloride (PubChem CID 67358979) has the molecular formula C11H25ClN2O
and a molecular weight of 236.79 g/mol. Its IUPAC name is azane;4-cyclohexyloxan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | azane;4-cyclohexyloxan-3-amine;hydrochloride |
| PubChem CID | 67358979 |
| Molecular Formula | C11H25ClN2O |
| Molecular Weight | 236.79 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | azane;4-cyclohexyloxan-3-amine;hydrochloride |
| SMILES | Cl.N.NC1COCCC1C1CCCCC1 |
| InChI | InChI=1S/C11H21NO.ClH.H3N/c12-11-8-13-7-6-10(11)9-4-2-1-3-5-9;;/h9-11H,1-8,12H2;1H;1H3 |
| InChIKey | AUERLEDQWJZVFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;4-cyclohexyloxan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-cyclohexyloxan-3-amine;hydrochloride?
The IUPAC name of azane;4-cyclohexyloxan-3-amine;hydrochloride (CID 67358979) is azane;4-cyclohexyloxan-3-amine;hydrochloride.
What is the SMILES notation for azane;4-cyclohexyloxan-3-amine;hydrochloride?
The canonical SMILES for azane;4-cyclohexyloxan-3-amine;hydrochloride is Cl.N.NC1COCCC1C1CCCCC1.
What is the InChIKey of azane;4-cyclohexyloxan-3-amine;hydrochloride?
The InChIKey is AUERLEDQWJZVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO.ClH.H3N/c12-11-8-13-7-6-10(11)9-4-2-1-3-5-9;;/h9-11H,1-8,12H2;1H;1H3.
What are the key properties of azane;4-cyclohexyloxan-3-amine;hydrochloride?
azane;4-cyclohexyloxan-3-amine;hydrochloride has a molecular weight of 236.79 g/mol, XLogP of 2.51, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-cyclohexyloxan-3-amine;hydrochloride is sourced from PubChem (CID 67358979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).