About 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one
1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one (PubChem CID 67359164) has the molecular formula C26H30ClN3O
and a molecular weight of 436.00 g/mol. Its IUPAC name is 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one.
Molecular Properties
| Compound Name | 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one |
| PubChem CID | 67359164 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one |
| SMILES | Cc1c(C)n(C)c2c(Cn3c(=O)n(CC4CCCCC4)c4ccccc43)cc(Cl)cc12 |
| InChI | InChI=1S/C26H30ClN3O/c1-17-18(2)28(3)25-20(13-21(27)14-22(17)25)16-30-24-12-8-7-11-23(24)29(26(30)31)15-19-9-5-4-6-10-19/h7-8,11-14,19H,4-6,9-10,15-16H2,1-3H3 |
| InChIKey | SEKGDVYQZGFROU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 31.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one?
The IUPAC name of 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one (CID 67359164) is 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one.
What is the SMILES notation for 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one?
The canonical SMILES for 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one is Cc1c(C)n(C)c2c(Cn3c(=O)n(CC4CCCCC4)c4ccccc43)cc(Cl)cc12.
What is the InChIKey of 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one?
The InChIKey is SEKGDVYQZGFROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30ClN3O/c1-17-18(2)28(3)25-20(13-21(27)14-22(17)25)16-30-24-12-8-7-11-23(24)29(26(30)31)15-19-9-5-4-6-10-19/h7-8,11-14,19H,4-6,9-10,15-16H2,1-3H3.
What are the key properties of 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one?
1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one has a molecular weight of 436.00 g/mol, XLogP of 6.19, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-1,2,3-trimethylindol-7-yl)methyl]-3-(cyclohexylmethyl)benzimidazol-2-one is sourced from PubChem (CID 67359164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).