About azane;4-cyclopropyloxan-3-amine;dihydrochloride
azane;4-cyclopropyloxan-3-amine;dihydrochloride (PubChem CID 67359568) has the molecular formula C8H20Cl2N2O
and a molecular weight of 231.17 g/mol. Its IUPAC name is azane;4-cyclopropyloxan-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | azane;4-cyclopropyloxan-3-amine;dihydrochloride |
| PubChem CID | 67359568 |
| Molecular Formula | C8H20Cl2N2O |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | azane;4-cyclopropyloxan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N.NC1COCCC1C1CC1 |
| InChI | InChI=1S/C8H15NO.2ClH.H3N/c9-8-5-10-4-3-7(8)6-1-2-6;;;/h6-8H,1-5,9H2;2*1H;1H3 |
| InChIKey | PDQFZDXFHDROFB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;4-cyclopropyloxan-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-cyclopropyloxan-3-amine;dihydrochloride?
The IUPAC name of azane;4-cyclopropyloxan-3-amine;dihydrochloride (CID 67359568) is azane;4-cyclopropyloxan-3-amine;dihydrochloride.
What is the SMILES notation for azane;4-cyclopropyloxan-3-amine;dihydrochloride?
The canonical SMILES for azane;4-cyclopropyloxan-3-amine;dihydrochloride is Cl.Cl.N.NC1COCCC1C1CC1.
What is the InChIKey of azane;4-cyclopropyloxan-3-amine;dihydrochloride?
The InChIKey is PDQFZDXFHDROFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.2ClH.H3N/c9-8-5-10-4-3-7(8)6-1-2-6;;;/h6-8H,1-5,9H2;2*1H;1H3.
What are the key properties of azane;4-cyclopropyloxan-3-amine;dihydrochloride?
azane;4-cyclopropyloxan-3-amine;dihydrochloride has a molecular weight of 231.17 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-cyclopropyloxan-3-amine;dihydrochloride is sourced from PubChem (CID 67359568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).