C33H40O5Si — CID 67360139
tert-butyl-[(5-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl)methoxy]-diphenylsilane (PubChem CID 67360139) has the molecular formula C33H40O5Si and a molecular weight of 544.76 g/mol. Its IUPAC name is tert-butyl-[(5-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(5-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 67360139 |
| Molecular Formula | C33H40O5Si |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | tert-butyl-[(5-ethenyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl)methoxy]-diphenylsilane |
| SMILES | C=CC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC2OC(C)(C)OC2C1OCc1ccccc1 |
| InChI | InChI=1S/C33H40O5Si/c1-7-33(29(34-23-25-17-11-8-12-18-25)28-30(38-33)37-32(5,6)36-28)24-35-39(31(2,3)4,26-19-13-9-14-20-26)27-21-15-10-16-22-27/h7-22,28-30H,1,23-24H2,2-6H3 |
| InChIKey | PSXCAIWBFQCBKG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|