About [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid
[4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid (PubChem CID 67360340) has the molecular formula C22H24BNO2
and a molecular weight of 345.25 g/mol. Its IUPAC name is [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid |
| PubChem CID | 67360340 |
| Molecular Formula | C22H24BNO2 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid |
| SMILES | Cc1ccc(N(c2ccc(B(O)O)cc2)c2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H24BNO2/c1-15-5-9-20(10-6-15)24(21-11-7-19(8-12-21)23(25)26)22-17(3)13-16(2)14-18(22)4/h5-14,25-26H,1-4H3 |
| InChIKey | CVBSPSBATALFLC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid?
The IUPAC name of [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid (CID 67360340) is [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid.
What is the SMILES notation for [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid?
The canonical SMILES for [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid is Cc1ccc(N(c2ccc(B(O)O)cc2)c2c(C)cc(C)cc2C)cc1.
What is the InChIKey of [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid?
The InChIKey is CVBSPSBATALFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BNO2/c1-15-5-9-20(10-6-15)24(21-11-7-19(8-12-21)23(25)26)22-17(3)13-16(2)14-18(22)4/h5-14,25-26H,1-4H3.
What are the key properties of [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid?
[4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid has a molecular weight of 345.25 g/mol, XLogP of 4.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]boronic acid is sourced from PubChem (CID 67360340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).