C17H14F2N4O4 — CID 6736047
N'-[2-(3,4-difluorophenyl)acetyl]-3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carbohydrazide (PubChem CID 6736047) has the molecular formula C17H14F2N4O4 and a molecular weight of 376.32 g/mol. Its IUPAC name is N'-[2-(3,4-difluorophenyl)acetyl]-3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carbohydrazide.
| Compound Name | N'-[2-(3,4-difluorophenyl)acetyl]-3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 6736047 |
| Molecular Formula | C17H14F2N4O4 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N'-[2-(3,4-difluorophenyl)acetyl]-3-methyl-5-(5-methyl-1,2-oxazol-3-yl)-1,2-oxazole-4-carbohydrazide |
| SMILES | Cc1cc(-c2onc(C)c2C(=O)NNC(=O)Cc2ccc(F)c(F)c2)no1 |
| InChI | InChI=1S/C17H14F2N4O4/c1-8-5-13(23-26-8)16-15(9(2)22-27-16)17(25)21-20-14(24)7-10-3-4-11(18)12(19)6-10/h3-6H,7H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | XZJMWRKNXUJTMC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|