About 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid
2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid (PubChem CID 67360702) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid.
Molecular Properties
| Compound Name | 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid |
| PubChem CID | 67360702 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid |
| SMILES | CCc1cn2cccc(C(=O)O)c2n1 |
| InChI | InChI=1S/C10H10N2O2/c1-2-7-6-12-5-3-4-8(10(13)14)9(12)11-7/h3-6H,2H2,1H3,(H,13,14) |
| InChIKey | RZMDPTLURGBEIE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid?
The IUPAC name of 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid (CID 67360702) is 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid.
What is the SMILES notation for 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid?
The canonical SMILES for 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid is CCc1cn2cccc(C(=O)O)c2n1.
What is the InChIKey of 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid?
The InChIKey is RZMDPTLURGBEIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-7-6-12-5-3-4-8(10(13)14)9(12)11-7/h3-6H,2H2,1H3,(H,13,14).
What are the key properties of 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid?
2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid has a molecular weight of 190.20 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylimidazo[1,2-a]pyridine-8-carboxylic acid is sourced from PubChem (CID 67360702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).