C22H25F3N4O3SSi — CID 67360930
trimethyl-[2-[[4-(3-methylsulfonylphenyl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane (PubChem CID 67360930) has the molecular formula C22H25F3N4O3SSi and a molecular weight of 510.61 g/mol. Its IUPAC name is trimethyl-[2-[[4-(3-methylsulfonylphenyl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[4-(3-methylsulfonylphenyl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 67360930 |
| Molecular Formula | C22H25F3N4O3SSi |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | trimethyl-[2-[[4-(3-methylsulfonylphenyl)-12-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-5-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cccc(S(C)(=O)=O)c2)cc2c1ncc1cnc(C(F)(F)F)n12 |
| InChI | InChI=1S/C22H25F3N4O3SSi/c1-33(30,31)17-7-5-6-15(10-17)18-11-19-20(28(18)14-32-8-9-34(2,3)4)26-12-16-13-27-21(29(16)19)22(23,24)25/h5-7,10-13H,8-9,14H2,1-4H3 |
| InChIKey | JJCWACAHTWTSMR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|