C14H22N2 — CID 67361044
3-tert-butyl-7-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 67361044) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-tert-butyl-7-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 3-tert-butyl-7-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 67361044 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 3-tert-butyl-7-prop-2-enyl-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | C=CCC1CCCc2c(C(C)(C)C)n[nH]c21 |
| InChI | InChI=1S/C14H22N2/c1-5-7-10-8-6-9-11-12(10)15-16-13(11)14(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,15,16) |
| InChIKey | AQAQRZBQLMBZJH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|