C21H14N4 — CID 67361069
2-(9-amino-9H-fluoren-4-yl)-3H-benzimidazole-5-carbonitrile (PubChem CID 67361069) has the molecular formula C21H14N4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-(9-amino-9H-fluoren-4-yl)-3H-benzimidazole-5-carbonitrile.
| Compound Name | 2-(9-amino-9H-fluoren-4-yl)-3H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 67361069 |
| Molecular Formula | C21H14N4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-(9-amino-9H-fluoren-4-yl)-3H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(-c3cccc4c3-c3ccccc3C4N)[nH]c2c1 |
| InChI | InChI=1S/C21H14N4/c22-11-12-8-9-17-18(10-12)25-21(24-17)16-7-3-6-15-19(16)13-4-1-2-5-14(13)20(15)23/h1-10,20H,23H2,(H,24,25) |
| InChIKey | DAEJILNIOCGPRS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |