C23H30N4O5Si — CID 67361206
[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid (PubChem CID 67361206) has the molecular formula C23H30N4O5Si and a molecular weight of 470.60 g/mol. Its IUPAC name is [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid.
| Compound Name | [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67361206 |
| Molecular Formula | C23H30N4O5Si |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid |
| SMILES | CC1(c2ccc(-c3cc4nc(NC(=O)O)cnc4n3COCC[Si](C)(C)C)cc2)OCCO1 |
| InChI | InChI=1S/C23H30N4O5Si/c1-23(31-9-10-32-23)17-7-5-16(6-8-17)19-13-18-21(24-14-20(25-18)26-22(28)29)27(19)15-30-11-12-33(2,3)4/h5-8,13-14H,9-12,15H2,1-4H3,(H,25,26)(H,28,29) |
| InChIKey | DRFMSSMQALUFRB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|