C25H23FN4O3S — CID 67361223
2-[3-fluoro-4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol (PubChem CID 67361223) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[3-fluoro-4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol.
| Compound Name | 2-[3-fluoro-4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 67361223 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[3-fluoro-4-[12-methyl-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-10-yl]phenyl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2c(-c4ccc(C(C)(C)O)cc4F)nc(C)n23)cc1 |
| InChI | InChI=1S/C25H23FN4O3S/c1-15-5-8-18(9-6-15)34(32,33)29-12-11-21-24(29)27-14-22-23(28-16(2)30(21)22)19-10-7-17(13-20(19)26)25(3,4)31/h5-14,31H,1-4H3 |
| InChIKey | QBDCAJIFWPMGKZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |