C20H21N5O2S — CID 67361303
cis-(1R,3S)-3-[4-(3-methylsulfonylphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine (PubChem CID 67361303) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is cis-(1R,3S)-3-[4-(3-methylsulfonylphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine.
| Compound Name | cis-(1R,3S)-3-[4-(3-methylsulfonylphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 67361303 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | cis-(1R,3S)-3-[4-(3-methylsulfonylphenyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2cc3c(ncc4cnc([C@H]5CC[C@@H](N)C5)n43)[nH]2)c1 |
| InChI | InChI=1S/C20H21N5O2S/c1-28(26,27)16-4-2-3-12(8-16)17-9-18-19(24-17)22-10-15-11-23-20(25(15)18)13-5-6-14(21)7-13/h2-4,8-11,13-14,24H,5-7,21H2,1H3/t13-,14+/m0/s1 |
| InChIKey | JBTMHSPAMSHRKR-UONOGXRCSA-N |
| XLogP | 2.88 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |