C25H19F5N4O4S — CID 67361326
[N-(2,5-difluorophenyl)sulfonyl-2,4-difluoro-3-[1-(2-fluoroethyl)-4-pyridin-4-ylpyrazol-3-yl]anilino]methyl acetate (PubChem CID 67361326) has the molecular formula C25H19F5N4O4S and a molecular weight of 566.51 g/mol. Its IUPAC name is [N-(2,5-difluorophenyl)sulfonyl-2,4-difluoro-3-[1-(2-fluoroethyl)-4-pyridin-4-ylpyrazol-3-yl]anilino]methyl acetate.
| Compound Name | [N-(2,5-difluorophenyl)sulfonyl-2,4-difluoro-3-[1-(2-fluoroethyl)-4-pyridin-4-ylpyrazol-3-yl]anilino]methyl acetate |
|---|---|
| PubChem CID | 67361326 |
| Molecular Formula | C25H19F5N4O4S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | [N-(2,5-difluorophenyl)sulfonyl-2,4-difluoro-3-[1-(2-fluoroethyl)-4-pyridin-4-ylpyrazol-3-yl]anilino]methyl acetate |
| SMILES | CC(=O)OCN(c1ccc(F)c(-c2nn(CCF)cc2-c2ccncc2)c1F)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C25H19F5N4O4S/c1-15(35)38-14-34(39(36,37)22-12-17(27)2-3-19(22)28)21-5-4-20(29)23(24(21)30)25-18(13-33(32-25)11-8-26)16-6-9-31-10-7-16/h2-7,9-10,12-13H,8,11,14H2,1H3 |
| InChIKey | GSFRAYDVIIYJHY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|