C21H20BrN5O3S — CID 67361729
1-[(2R)-2-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone (PubChem CID 67361729) has the molecular formula C21H20BrN5O3S and a molecular weight of 502.39 g/mol. Its IUPAC name is 1-[(2R)-2-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 67361729 |
| Molecular Formula | C21H20BrN5O3S |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 1-[(2R)-2-[10-bromo-5-(4-methylphenyl)sulfonyl-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H]1c1nc(Br)c2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)n12 |
| InChI | InChI=1S/C21H20BrN5O3S/c1-13-5-7-15(8-6-13)31(29,30)26-11-9-17-20(26)23-12-18-19(22)24-21(27(17)18)16-4-3-10-25(16)14(2)28/h5-9,11-12,16H,3-4,10H2,1-2H3/t16-/m1/s1 |
| InChIKey | FAABFMXNCUAWOZ-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |