About 9H-pyrido[2,3-b]indole;2H-triazole
9H-pyrido[2,3-b]indole;2H-triazole (PubChem CID 67361735) has the molecular formula C13H11N5
and a molecular weight of 237.27 g/mol. Its IUPAC name is 9H-pyrido[2,3-b]indole;2H-triazole.
Molecular Properties
| Compound Name | 9H-pyrido[2,3-b]indole;2H-triazole |
| PubChem CID | 67361735 |
| Molecular Formula | C13H11N5 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 9H-pyrido[2,3-b]indole;2H-triazole |
| SMILES | c1ccc2c(c1)[nH]c1ncccc12.c1cn[nH]n1 |
| InChI | InChI=1S/C11H8N2.C2H3N3/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10;1-2-4-5-3-1/h1-7H,(H,12,13);1-2H,(H,3,4,5) |
| InChIKey | HGGNVBIIKDOUDA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-pyrido[2,3-b]indole;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrido[2,3-b]indole;2H-triazole?
The IUPAC name of 9H-pyrido[2,3-b]indole;2H-triazole (CID 67361735) is 9H-pyrido[2,3-b]indole;2H-triazole.
What is the SMILES notation for 9H-pyrido[2,3-b]indole;2H-triazole?
The canonical SMILES for 9H-pyrido[2,3-b]indole;2H-triazole is c1ccc2c(c1)[nH]c1ncccc12.c1cn[nH]n1.
What is the InChIKey of 9H-pyrido[2,3-b]indole;2H-triazole?
The InChIKey is HGGNVBIIKDOUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.C2H3N3/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10;1-2-4-5-3-1/h1-7H,(H,12,13);1-2H,(H,3,4,5).
What are the key properties of 9H-pyrido[2,3-b]indole;2H-triazole?
9H-pyrido[2,3-b]indole;2H-triazole has a molecular weight of 237.27 g/mol, XLogP of 2.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrido[2,3-b]indole;2H-triazole is sourced from PubChem (CID 67361735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).