C25H34N4O5Si — CID 67361762
[7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid (PubChem CID 67361762) has the molecular formula C25H34N4O5Si and a molecular weight of 498.66 g/mol. Its IUPAC name is [7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid.
| Compound Name | [7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67361762 |
| Molecular Formula | C25H34N4O5Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [7-ethyl-6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]carbamic acid |
| SMILES | CCc1c(-c2ccc(C3(C)OCCO3)cc2)n(COCC[Si](C)(C)C)c2ncc(NC(=O)O)nc12 |
| InChI | InChI=1S/C25H34N4O5Si/c1-6-19-21-23(26-15-20(27-21)28-24(30)31)29(16-32-13-14-35(3,4)5)22(19)17-7-9-18(10-8-17)25(2)33-11-12-34-25/h7-10,15H,6,11-14,16H2,1-5H3,(H,27,28)(H,30,31) |
| InChIKey | SOJJBDOXEHZFQH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|