C25H23FN4O3S — CID 67361798
12-ethyl-5-(3-fluoro-4-methoxyphenyl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 67361798) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is 12-ethyl-5-(3-fluoro-4-methoxyphenyl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 12-ethyl-5-(3-fluoro-4-methoxyphenyl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 67361798 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 12-ethyl-5-(3-fluoro-4-methoxyphenyl)-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CCc1cn(S(=O)(=O)c2ccc(C)cc2)c2ncc3c(-c4ccc(OC)c(F)c4)nn(C)c3c12 |
| InChI | InChI=1S/C25H23FN4O3S/c1-5-16-14-30(34(31,32)18-9-6-15(2)7-10-18)25-22(16)24-19(13-27-25)23(28-29(24)3)17-8-11-21(33-4)20(26)12-17/h6-14H,5H2,1-4H3 |
| InChIKey | IBFQQBBTTDCQAW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |