C18H21BrN4O — CID 67361838
(6-bromo-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-(1-methyl-5-pyrrol-1-ylpyrazol-4-yl)methanone (PubChem CID 67361838) has the molecular formula C18H21BrN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is (6-bromo-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-(1-methyl-5-pyrrol-1-ylpyrazol-4-yl)methanone.
| Compound Name | (6-bromo-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-(1-methyl-5-pyrrol-1-ylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 67361838 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (6-bromo-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-(1-methyl-5-pyrrol-1-ylpyrazol-4-yl)methanone |
| SMILES | Cn1ncc(C(=O)N2CCC3CC(Br)CC=C3C2)c1-n1cccc1 |
| InChI | InChI=1S/C18H21BrN4O/c1-21-17(22-7-2-3-8-22)16(11-20-21)18(24)23-9-6-13-10-15(19)5-4-14(13)12-23/h2-4,7-8,11,13,15H,5-6,9-10,12H2,1H3 |
| InChIKey | DIXFPIJFJJCGNC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|