C27H36N4O5Si — CID 67362056
[6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-(2-methylprop-2-enyl)carbamic acid (PubChem CID 67362056) has the molecular formula C27H36N4O5Si and a molecular weight of 524.69 g/mol. Its IUPAC name is [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-(2-methylprop-2-enyl)carbamic acid.
| Compound Name | [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-(2-methylprop-2-enyl)carbamic acid |
|---|---|
| PubChem CID | 67362056 |
| Molecular Formula | C27H36N4O5Si |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | [6-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-2-yl]-(2-methylprop-2-enyl)carbamic acid |
| SMILES | C=C(C)CN(C(=O)O)c1cnc2c(cc(-c3ccc(C4(C)OCCO4)cc3)n2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C27H36N4O5Si/c1-19(2)17-30(26(32)33)24-16-28-25-22(29-24)15-23(31(25)18-34-13-14-37(4,5)6)20-7-9-21(10-8-20)27(3)35-11-12-36-27/h7-10,15-16H,1,11-14,17-18H2,2-6H3,(H,32,33) |
| InChIKey | ZALOJCJSKRMEQV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|