C31H34N6O4S — CID 67362094
4-[12-ethyl-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 67362094) has the molecular formula C31H34N6O4S and a molecular weight of 586.72 g/mol. Its IUPAC name is 4-[12-ethyl-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 4-[12-ethyl-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 67362094 |
| Molecular Formula | C31H34N6O4S |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 4-[12-ethyl-3-methyl-10-(4-methylphenyl)sulfonyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | CCc1c(-c2ccc(C(=O)NCCN3CCOCC3)cc2)n(S(=O)(=O)c2ccc(C)cc2)c2ncc3cnn(C)c3c12 |
| InChI | InChI=1S/C31H34N6O4S/c1-4-26-27-29-24(20-34-35(29)3)19-33-30(27)37(42(39,40)25-11-5-21(2)6-12-25)28(26)22-7-9-23(10-8-22)31(38)32-13-14-36-15-17-41-18-16-36/h5-12,19-20H,4,13-18H2,1-3H3,(H,32,38) |
| InChIKey | OURIVEBFWCRGKJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |